RefMet Compound Details
MW structure | 38841 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | gamma-Glutamylalanine | |
Alternative name | Gamma-Glutamylalanine | |
Systematic name | (2S)-2-amino-4-{[(1S)-1-carboxyethyl]carbamoyl}butanoic acid | |
SMILES | C[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 218.090273 (neutral) |
Table of KEGG reactions in human pathways involving gamma-Glutamylalanine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03749 | (5-L-Glutamyl)-L-amino acid <=> 5-Oxoproline + L-Amino acid | (5-L-glutamyl)-L-amino-acid gamma-glutamyl cyclotransferase (5-oxoproline-forming) |
R01262 | Glutathione + L-Amino acid <=> Cys-Gly + (5-L-Glutamyl)-L-amino acid | glutathione:L-amino-acid 5-glutamyltransferase |
Table of KEGG human pathways containing gamma-Glutamylalanine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00480 | Glutathione metabolism | 2 |