RefMet Compound Details
RefMet ID | RM0136070 | |
---|---|---|
MW structure | 37652 (View MW Metabolite Database details) | |
RefMet name | dUTP Species distribution Sample source distribution | |
Systematic name | 2'-Deoxyuridine 5'-triphosphate | |
SMILES | c1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 467.973622 (neutral) |
Table of KEGG reactions in human pathways involving dUTP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02100 | dUTP + H2O <=> dUMP + Diphosphate | dUTP nucleotidohydrolase |
R02330 | dUTP + H2O <=> dUDP + Orthophosphate | dUTP nucleotidohydrolase |
R02331 | ATP + dUDP <=> ADP + dUTP | ATP:dUDP phosphotransferase |
Table of KEGG human pathways containing dUTP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |