RefMet Compound Details
MW structure | 37779 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dUMP | |
Systematic name | {[(2R,3S,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid | |
SMILES | c1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)O)O2)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 308.040956 (neutral) |
Table of KEGG reactions in human pathways involving dUMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01663 | dCMP + H2O <=> dUMP + Ammonia | dCMP aminohydrolase |
R02098 | ATP + dUMP <=> ADP + dUDP | ATP:dUMP phosphotransferase |
R02099 | ATP + Deoxyuridine <=> ADP + dUMP | ATP:deoxyuridine 5'-phosphotransferase |
R02100 | dUTP + H2O <=> dUMP + Diphosphate | dUTP nucleotidohydrolase |
R02101 | dUMP + 5,10-Methylenetetrahydrofolate <=> Dihydrofolate + dTMP | 5,10-Methylenetetrahydrofolate:dUMP C-methyltransferase |
R02102 | dUMP + H2O <=> Deoxyuridine + Orthophosphate | 2'-deoxyuridine 5'-monophosphate phosphohydrolase |
Table of KEGG human pathways containing dUMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 6 |
hsa00670 | One carbon pool by folate | 1 |