RefMet Compound Details
MW structure | 37671 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dTMP | |
Systematic name | 5-Thymidylic acid | |
SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 322.056606 (neutral) |
Table of KEGG reactions in human pathways involving dTMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01569 | dTMP + H2O <=> Thymidine + Orthophosphate | thymidylate 5'-phosphohydrolase |
R02092 | dTDP + H2O <=> dTMP + Orthophosphate | dTDP phosphohydrolase |
R02101 | dUMP + 5,10-Methylenetetrahydrofolate <=> Dihydrofolate + dTMP | 5,10-Methylenetetrahydrofolate:dUMP C-methyltransferase |
R01567 | ATP + Thymidine <=> ADP + dTMP | ATP:thymidine 5'-phosphotransferase |
R11323 | dTTP + H2O <=> dTMP + Diphosphate | dTTP diphosphohydrolase |
R02094 | ATP + dTMP <=> ADP + dTDP | ATP:dTMP phosphotransferase |
Table of KEGG human pathways containing dTMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 6 |
hsa00670 | One carbon pool by folate | 1 |