RefMet Compound Details
MW structure | 37701 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dTDP | |
Systematic name | {[hydroxy({[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)oxolan-2-yl]methoxy})phosphoryl]oxy}phosphonic acid | |
SMILES | CC1=CN([C@@H]2C[C@@H](O)[C@H](COP(O)(=O)OP(O)(O)=O)O2)C(=O)NC1=O | |
Exact mass | 402.022939 (neutral) |
Table of KEGG reactions in human pathways involving dTDP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02092 | dTDP + H2O <=> dTMP + Orthophosphate | dTDP phosphohydrolase |
R02093 | ATP + dTDP <=> ADP + dTTP | ATP:dTDP phosphotransferase |
R02094 | ATP + dTMP <=> ADP + dTDP | ATP:dTMP phosphotransferase |
R02095 | dTTP + H2O <=> dTDP + Orthophosphate | dTTP nucleotidohydrolase |
Table of KEGG human pathways containing dTDP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 4 |