RefMet Compound Details
MW structure | 37538 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dCTP | |
Systematic name | 2'-deoxycytidine 5'-triphosphate | |
SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 466.989606 (neutral) |
Table of KEGG reactions in human pathways involving dCTP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02326 | ATP + dCDP <=> ADP + dCTP | ATP:dCDP phosphotransferase |
R01668 | dCTP + H2O <=> dCMP + Diphosphate | dCTP nucleotidohydrolase |
Table of KEGG human pathways containing dCTP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 2 |