RefMet Compound Details
RefMet ID | RM0159828 | |
---|---|---|
MW structure | 49893 (View MW Metabolite Database details) | |
RefMet name | dADP Species distribution Sample source distribution | |
Systematic name | 2'-deoxyadenosine 5'-diphosphate | |
SMILES | C1[C@@H]([C@@H](COP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)ncnc12)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 411.034506 (neutral) |
Table of KEGG reactions in human pathways involving dADP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01137 | ATP + dADP <=> ADP + dATP | ATP:dADP phosphotransferase |
R01138 | dATP + Pyruvate <=> dADP + Phosphoenolpyruvate | dATP:pyruvate 2-O-phosphotransferase |
R01547 | ATP + dAMP <=> ADP + dADP | ATP:dAMP phosphotransferase |
R02017 | dADP + Thioredoxin disulfide + H2O <=> Thioredoxin + ADP | 2'-Deoxyadenosine 5'-diphosphate:oxidized-thioredoxin 2'-oxidoreductase |
Table of KEGG human pathways containing dADP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 4 |