RefMet Compound Details
RefMet ID | RM0136055 | |
---|---|---|
MW structure | 37593 (View MW Metabolite Database details) | |
RefMet name | Uroporphyrinogen III Species distribution Sample source distribution | |
Systematic name | 3-[9,14,20-tris(2-carboxyethyl)-5,10,15,19-tetrakis(carboxymethyl)-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1(20),3,5,8,10,13,15,18-octaen-4-yl]propanoic acid | |
SMILES | C(CC(=O)O)c1c(CC(=O)O)c2Cc3c(CCC(=O)O)c(CC(=O)O)c(Cc4c(CCC(=O)O)c(CC(=O)O)c(Cc5c(CC(=O)O)c(CCC(=O)O)c(Cc1[nH]2)[nH]5)[nH]4)[nH]3 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 836.275236 (neutral) |
Table of KEGG reactions in human pathways involving Uroporphyrinogen III
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03165 | Hydroxymethylbilane <=> Uroporphyrinogen III + H2O | Hydroxymethylbilane hydro-lyase(cyclizing) |
R03197 | Uroporphyrinogen III <=> Coproporphyrinogen III + 4 CO2 | Uroporphyrinogen-III carboxy-lyase |
Table of KEGG human pathways containing Uroporphyrinogen III
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00860 | Porphyrin and chlorophyll metabolism | 2 |