RefMet Compound Details
MW structure | 49820 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Urocortisone | |
Systematic name | 3alpha,17alpha,21-trihydroxy-5beta-pregnane-11,20-dione | |
SMILES | C[C@]12CC[C@H](C[C@H]1CC[C@H]1[C@@H]3CC[C@](C(=O)CO)([C@@]3(C)CC(=O)[C@H]21)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 364.224975 (neutral) |
Table of KEGG reactions in human pathways involving Urocortisone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04829 | Tetrahydrocortisone + NAD+ <=> 17alpha,21-Dihydroxy-5beta-pregnane-3,11,20-trione + NADH + H+ | Urocortisone:NAD+ oxidoreductase (B-specific) |
R04830 | 17alpha,21-Dihydroxy-5beta-pregnane-3,11,20-trione + H+ + NADPH <=> Tetrahydrocortisone + NADP+ | Urocortisone:NADP+ oxidoreductase (B-specific) |
Table of KEGG human pathways containing Urocortisone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |