RefMet Compound Details
MW structure | 37180 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | UTP | |
Systematic name | Uridine 5'-triphosphate | |
SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 483.968537 (neutral) |
Table of KEGG reactions in human pathways involving UTP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00969 | P1,P4-Bis(5'-uridyl) tetraphosphate + H2O <=> UTP + UMP | P1,P4-bis(5'-uridyl)-tetraphosphate uridylohydrolase |
R00159 | UTP + H2O <=> UDP + Orthophosphate | UTP phosphohydrolase |
R00156 | ATP + UDP <=> ADP + UTP | ATP:UDP phosphotransferase |
R00662 | UTP + H2O <=> UMP + Diphosphate | Uridine triphosphate pyrophosphohydrolase |
R00568 | CTP + H2O <=> UTP + Ammonia | CTP aminohydrolase |
R00573 | ATP + UTP + L-Glutamine + H2O <=> ADP + Orthophosphate + CTP + L-Glutamate | UTP:L-glutamine amido-ligase (ADP-forming) |
R00571 | ATP + UTP + Ammonia <=> ADP + Orthophosphate + CTP | UTP:ammonia ligase (ADP-forming) |
Table of KEGG human pathways containing UTP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 6 |
hsa01100 | Metabolic pathways | 2 |
hsa01232 | Nucleotide metabolism | 2 |
hsa01240 | Biosynthesis of cofactors | 2 |