RefMet Compound Details

MW structure37182 (View MW Metabolite Database details)
RefMet nameUMP
Systematic name{[(2R,3S,4R,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid
SMILESO=c1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass324.035871 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC9H13N2O9PView other entries in RefMet with this formula
InChIInChI=1S/C9H13N2O9P/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18)/t4-
,6-,7-,8-/m1/s1
InChIKeyDJJCXFVJDGTHFX-XVFCMESISA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassNucleic acids
Main ClassPyrimidines
Sub ClassPyrimidine rNMP
Pubchem CID6030
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving UMP

Rxn IDKEGG ReactionEnzyme
R00964 ATP + Uridine <=> ADP + UMPATP:uridine 5'-phosphotransferase
R00968 GTP + Uridine <=> GDP + UMPGTP:uridine 5'-phosphotransferase
R00970 ITP + Uridine <=> IDP + UMPITP:uridine 5'-phosphotransferase
R00155 UDP + H2O <=> UMP + OrthophosphateUDP phosphohydrolase
R00967 UTP + Uridine <=> UDP + UMPUTP:uridine 5'-phosphotransferase
R00965 Orotidine 5'-phosphate <=> UMP + CO2orotidine-5'-phosphate carboxy-lyase (UMP-forming)
R01549 dATP + Uridine <=> dADP + UMPdATP:uridine 5'-phosphotransferase
R02332 dUTP + Uridine <=> dUDP + UMPdUTP:uridine 5'-phosphotransferase
R01880 dGTP + Uridine <=> dGDP + UMPdGTP:uridine 5'-phosphotransferase
R02097 dTTP + Uridine <=> dTDP + UMPdTTP:uridine 5'-phosphotransferase
R02327 dCTP + Uridine <=> dCDP + UMPdCTP:uridine 5'-phosphotransferase
R00662 UTP + H2O <=> UMP + DiphosphateUridine triphosphate pyrophosphohydrolase
R00963 UMP + H2O <=> Uridine + Orthophosphateuridine 5'-monophosphate phosphohydrolase
R00966 UMP + Diphosphate <=> Uracil + 5-Phospho-alpha-D-ribose 1-diphosphateUMP:diphosphate phospho-alpha-D-ribosyltransferase
R00158 ATP + UMP <=> ADP + UDPATP:UMP phosphotransferase

Table of KEGG human pathways containing UMP

Pathway IDHuman Pathway# of reactions
hsa00240 Pyrimidine metabolism 8
hsa01232 Nucleotide metabolism 2
hsa01100 Metabolic pathways 1
  logo