RefMet Compound Details
MW structure | 37189 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | UDP | |
Systematic name | [({[(2R,3S,4R,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid | |
SMILES | OP(O)(=O)OP(O)(=O)OC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)N1C=CC(=O)NC1=O | |
Exact mass | 404.002204 (neutral) |
Table of KEGG reactions in human pathways involving UDP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00155 | UDP + H2O <=> UMP + Orthophosphate | UDP phosphohydrolase |
R00159 | UTP + H2O <=> UDP + Orthophosphate | UTP phosphohydrolase |
R00156 | ATP + UDP <=> ADP + UTP | ATP:UDP phosphotransferase |
R00158 | ATP + UMP <=> ADP + UDP | ATP:UMP phosphotransferase |
R02018 | dUDP + Thioredoxin disulfide + H2O <=> Thioredoxin + UDP | 2'-Deoxyuridine 5'-diphosphate:oxidized-thioredoxin 2'-oxidoreductase |
Table of KEGG human pathways containing UDP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 5 |