RefMet Compound Details

MW structure37107 (View MW Metabolite Database details)
RefMet nameTyrosine
Systematic name(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid
SMILESN[C@@H](Cc1ccc(O)cc1)C(O)=O
Exact mass181.073894 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC9H11NO3View other entries in RefMet with this formula
InChIInChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1
InChIKeyOUYCCCASQSFEME-QMMMGPOBSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID6057
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)
Human quantitationView measurements in targeted assays on human samples

Table of KEGG reactions in human pathways involving Tyrosine

Rxn IDKEGG ReactionEnzyme
R01815 Tetrahydrobiopterin + L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + Dihydrobiopterin + H2OL-Tyrosine,tetrahydrobiopterin:oxygen oxidoreductase (3-hydroxylating)
R00731 L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + H2OL-Tyrosine:oxygen oxidoreductase
R00736 L-Tyrosine <=> Tyramine + CO2L-tyrosine carboxy-lyase (tyramine-forming)
R09830 L-Tyrosine + H2O + NAD+ <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + NADH + H+L-Tyrosine:NAD+ oxidoreductase (deaminating)
R01795 Tetrahydrobiopterin + L-Phenylalanine + Oxygen <=> Dihydrobiopterin + L-Tyrosine + H2OL-Phenylalanine,tetrahydrobiopterin:oxygen oxidoreductase (4-hydroxylating)
R00031 Oxygen + 2 L-Tyrosine <=> 2 3,4-Dihydroxy-L-phenylalanine1,2-benzenediol:oxygen oxidoreductase
R00734 L-Tyrosine + 2-Oxoglutarate <=> 3-(4-Hydroxyphenyl)pyruvate + L-GlutamateL-tyrosine:2-oxoglutarate aminotransferase
R09254 L-Tyrosine + Pyruvate <=> 3-(4-Hydroxyphenyl)pyruvate + L-AlanineL-tyrosine:pyruvate aminotransferase
R12611 L-Tyrosine + Hydrogen peroxide <=> 3,4-Dihydroxy-L-phenylalanine + H2OL-tyrosine:hydrogen-peroxide oxidoreductase (L-dopa-forming)
R02078 3,4-Dihydroxy-L-phenylalanine + L-Tyrosine + Oxygen <=> Dopaquinone + 3,4-Dihydroxy-L-phenylalanine + H2OL-Tyrosine,L-dopa:oxygen oxidoreductase
R00729 L-Tyrosine + H2O + Oxygen <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + Hydrogen peroxideL-Tyrosine:oxygen oxidoreductase (deaminating)
R03539 Hydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-TyrosineHydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-Tyrosine
R02918 ATP + L-Tyrosine + tRNA(Tyr) <=> AMP + Diphosphate + L-Tyrosyl-tRNA(Tyr)L-Tyrosine:tRNA(Tyr) ligase (AMP-forming)

Table of KEGG human pathways containing Tyrosine

Pathway IDHuman Pathway# of reactions
hsa00350 Tyrosine metabolism 7
hsa01100 Metabolic pathways 4
hsa00400 Phenylalanine, tyrosine and tryptophan biosynthesis 3
hsa01230 Biosynthesis of amino acids 2
hsa00130 Ubiquinone and other terpenoid-quinone biosynthesis 1
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa00360 Phenylalanine metabolism 1
  logo