RefMet Compound Details

MW structure37505 (View MW Metabolite Database details)
RefMet nameTryptophan
Systematic name(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid
SMILESc1ccc2c(c1)c(C[C@@H](C(=O)O)N)c[nH]2   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass204.089878 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC11H12N2O2View other entries in RefMet with this formula
InChIInChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1
InChIKeyQIVBCDIJIAJPQS-VIFPVBQESA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID6305
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Tryptophan

Rxn IDKEGG ReactionEnzyme
R00677 L-Tryptophan + H2O + Oxygen <=> Indolepyruvate + Ammonia + Hydrogen peroxideL-Tryptophan:oxygen oxidoreductase (deaminating)
R00678 L-Tryptophan + Oxygen <=> L-FormylkynurenineL-tryptophan:oxygen 2,3-oxidoreductase (decyclizing)
R01814 Tetrahydrobiopterin + L-Tryptophan + Oxygen <=> 5-Hydroxy-L-tryptophan + Dihydrobiopterin + H2OL-Tryptophan,tetrahydrobiopterin:oxygen oxidoreductase (5-hydroxylating)
R00684 L-Tryptophan + 2-Oxoglutarate <=> Indolepyruvate + L-GlutamateL-Tryptophan:2-oxoglutarate aminotransferase
R00685 L-Tryptophan <=> Tryptamine + CO2L-tryptophan decarboxy-lyase
R10180 L-Tryptophan + Pyruvate <=> Indolepyruvate + L-AlanineL-tryptophan:pyruvate aminotransferase
R12055 L-Methionine + Indolepyruvate <=> 4-Methylthio-2-oxobutanoic acid + L-TryptophanL-methionine:indole-3-pyruvic acid aminotransferase
R03664 ATP + L-Tryptophan + tRNA(Trp) <=> AMP + Diphosphate + L-Tryptophanyl-tRNA(Trp)L-Tryptophan -tRNA(Trp) ligase (AMP-forming)

Table of KEGG human pathways containing Tryptophan

Pathway IDHuman Pathway# of reactions
hsa00380 Tryptophan metabolism 4
hsa01100 Metabolic pathways 3
hsa00970 Aminoacyl-tRNA biosynthesis 1
  logo