RefMet Compound Details
MW structure | 37505 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Tryptophan | |
Systematic name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid | |
SMILES | c1ccc2c(c1)c(C[C@@H](C(=O)O)N)c[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 204.089878 (neutral) |
Table of KEGG reactions in human pathways involving Tryptophan
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00677 | L-Tryptophan + H2O + Oxygen <=> Indolepyruvate + Ammonia + Hydrogen peroxide | L-Tryptophan:oxygen oxidoreductase (deaminating) |
R00678 | L-Tryptophan + Oxygen <=> L-Formylkynurenine | L-tryptophan:oxygen 2,3-oxidoreductase (decyclizing) |
R01814 | Tetrahydrobiopterin + L-Tryptophan + Oxygen <=> 5-Hydroxy-L-tryptophan + Dihydrobiopterin + H2O | L-Tryptophan,tetrahydrobiopterin:oxygen oxidoreductase (5-hydroxylating) |
R00684 | L-Tryptophan + 2-Oxoglutarate <=> Indolepyruvate + L-Glutamate | L-Tryptophan:2-oxoglutarate aminotransferase |
R00685 | L-Tryptophan <=> Tryptamine + CO2 | L-tryptophan decarboxy-lyase |
R10180 | L-Tryptophan + Pyruvate <=> Indolepyruvate + L-Alanine | L-tryptophan:pyruvate aminotransferase |
R12055 | L-Methionine + Indolepyruvate <=> 4-Methylthio-2-oxobutanoic acid + L-Tryptophan | L-methionine:indole-3-pyruvic acid aminotransferase |
R03664 | ATP + L-Tryptophan + tRNA(Trp) <=> AMP + Diphosphate + L-Tryptophanyl-tRNA(Trp) | L-Tryptophan -tRNA(Trp) ligase (AMP-forming) |
Table of KEGG human pathways containing Tryptophan
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 4 |
hsa01100 | Metabolic pathways | 3 |
hsa00970 | Aminoacyl-tRNA biosynthesis | 1 |