RefMet Compound Details
MW structure | 2590 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | TXA2 | |
Systematic name | 9S,11S-epoxy,15S-hydroxy-thromboxa-5Z,13E-dien-1-oic acid | |
SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H](O1)O2)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 352.224975 (neutral) |
Table of KEGG reactions in human pathways involving TXA2
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02268 | Prostaglandin H2 <=> Thromboxane A2 | (5Z,13E)-(15S)-9alpha,11alpha-Epidioxy-15-hydroxyprosta-5,13-thromboxane-A2-isomerase |
Table of KEGG human pathways containing TXA2
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 1 |