RefMet Compound Details
MW structure | 37166 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Sucrose | |
Systematic name | alpha-D-glucopyranosyl-(1->2)-beta-D-fructofuranoside | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@]1(CO)[C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Sucrose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00801 | Sucrose + H2O <=> D-Fructose + D-Glucose | sucrose glucohydrolase |
R01103 | Raffinose + H2O <=> D-Galactose + Sucrose | Raffinose galactohydrolase |
Table of KEGG human pathways containing Sucrose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 2 |
hsa00500 | Starch and sucrose metabolism | 1 |