RefMet Compound Details

MW structure37123 (View MW Metabolite Database details)
RefMet nameSerine
Systematic name(2S)-2-amino-3-hydroxypropanoic acid
SMILESN[C@@H](CO)C(=O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass105.042594 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC3H7NO3View other entries in RefMet with this formula
InChIInChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
InChIKeyMTCFGRXMJLQNBG-REOHCLBHSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID5951
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Serine

Rxn IDKEGG ReactionEnzyme
R00589 L-Serine <=> D-Serineserine racemase
R00588 L-Serine + Glyoxylate <=> Hydroxypyruvate + GlycineL-Serine:glyoxylate aminotransferase
R03662 ATP + L-Serine + tRNA(Ser) <=> AMP + Diphosphate + L-Seryl-tRNA(Ser)L-Serine:tRNA(Ser) ligase (AMP-forming)
R12342 ADP + L-Serine <=> AMP + O-Phospho-L-serineADP:L-serine 3-phosphotransferase
R08218 ATP + L-Serine + tRNA(Sec) <=> AMP + Diphosphate + L-Seryl-tRNA(Sec)L-serine:tRNASec ligase (AMP-forming)
R00891 L-Serine + Hydrogen sulfide <=> L-Cysteine + H2OL-serine hydro-lyase (adding hydrogen sulfide, L-cysteine-forming)
R00585 L-Serine + Pyruvate <=> Hydroxypyruvate + L-AlanineL-Serine:pyruvate aminotransferase
R00582 O-Phospho-L-serine + H2O <=> L-Serine + OrthophosphateO-phospho-L-serine phosphohydrolase
R00590 L-Serine <=> Dehydroalanine + H2OL-serine hydro-lyase
R01290 L-Serine + L-Homocysteine <=> L-Cystathionine + H2OL-serine hydro-lyase (adding homocysteine
R00945 5,10-Methylenetetrahydrofolate + Glycine + H2O <=> Tetrahydrofolate + L-Serine5,10-Methylenetetrahydrofolate:glycine hydroxymethyltransferase
R09099 L-Serine + 5,6,7,8-Tetrahydromethanopterin <=> 5,10-Methylenetetrahydromethanopterin + Glycine + H2O5,10-methylenetetrahydromethanopterin:glycine hydroxymethyltransferase
R12344 ATP + L-Serine <=> ADP + O-Phospho-L-serineATP:L-serine 3-phosphotransferase
R00220 L-Serine <=> Pyruvate + AmmoniaL-serine ammonia-lyase

Table of KEGG human pathways containing Serine

Pathway IDHuman Pathway# of reactions
hsa00260 Glycine, serine and threonine metabolism 8
hsa01230 Biosynthesis of amino acids 4
hsa01200 Carbon metabolism 4
hsa01100 Metabolic pathways 3
hsa00630 Glyoxylate and dicarboxylate metabolism 2
hsa00970 Aminoacyl-tRNA biosynthesis 2
hsa00270 Cysteine and methionine metabolism 2
hsa00670 One carbon pool by folate 1
hsa00600 Sphingolipid metabolism 1
  logo