RefMet Compound Details
MW structure | 37647 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | S-Adenosylmethionine | |
Systematic name | [(3R)-3-amino-3-carboxypropyl]({[(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl})methylsulfanium | |
SMILES | C[S+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 399.145066 (neutral) |
Table of KEGG reactions in human pathways involving S-Adenosylmethionine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00178 | S-Adenosyl-L-methionine + H+ <=> S-Adenosylmethioninamine + CO2 | S-adenosyl-L-methionine carboxy-lyase [S-adenosyl 3-(methylsulfanyl)propylamine-forming] |
R00177 | Orthophosphate + Diphosphate + S-Adenosyl-L-methionine <=> ATP + L-Methionine + H2O | ATP:L-methionine S-adenosyltransferase |
R04858 | S-Adenosyl-L-methionine + DNA cytosine <=> S-Adenosyl-L-homocysteine + DNA 5-methylcytosine | S-adenosyl-L-methionine:DNA (cytosine-5-)-methyltransferase |
R10404 | S-Adenosyl-L-methionine <=> S-Adenosyl-L-homocysteine | S-Adenosyl-L-methionine <=> S-Adenosyl-L-homocysteine |
Table of KEGG human pathways containing S-Adenosylmethionine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00270 | Cysteine and methionine metabolism | 3 |
hsa00330 | Arginine and proline metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |
hsa01230 | Biosynthesis of amino acids | 1 |