RefMet Compound Details
MW structure | 37510 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | S-Adenosylhomocysteine | |
Systematic name | (2S)-2-amino-4-({[(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl}sulfanyl)butanoic acid | |
SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 384.121591 (neutral) |
Table of KEGG reactions in human pathways involving S-Adenosylhomocysteine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00192 | S-Adenosyl-L-homocysteine + H2O <=> Adenosine + L-Homocysteine | S-Adenosyl-L-homocysteine hydrolase |
R04858 | S-Adenosyl-L-methionine + DNA cytosine <=> S-Adenosyl-L-homocysteine + DNA 5-methylcytosine | S-adenosyl-L-methionine:DNA (cytosine-5-)-methyltransferase |
R10404 | S-Adenosyl-L-methionine <=> S-Adenosyl-L-homocysteine | S-Adenosyl-L-methionine <=> S-Adenosyl-L-homocysteine |
Table of KEGG human pathways containing S-Adenosylhomocysteine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00270 | Cysteine and methionine metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |