RefMet Compound Details
MW structure | 37179 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Ribose | |
Systematic name | (3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol | |
SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H]1O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 150.052825 (neutral) |
Table of KEGG reactions in human pathways involving Ribose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01051 | ATP + D-Ribose <=> ADP + D-Ribose 5-phosphate | ATP:D-ribose 5-phosphotransferase |
Table of KEGG human pathways containing Ribose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00030 | Pentose phosphate pathway | 1 |