RefMet Compound Details

RefMet IDRM0135419
MW structure29042 (View MW Metabolite Database details)
RefMet nameRetinoic acid
Systematic name3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2E,4E,6E,8E-tetraenoic acid
SMILESC/C(=C\C=C\C(=C\C(=O)O)\C)/C=C/C1=C(C)CCCC1(C)C   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass300.208930 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC20H28O2View other entries in RefMet with this formula
InChIInChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12
-11+,15-8+,16-14+
InChIKeySHGAZHPCJJPHSC-YCNIQYBTSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassPrenol Lipids
Main ClassIsoprenoids
Sub ClassRetinoids
Pubchem CID444795
ChEBI ID15367
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Retinoic acid

Rxn IDKEGG ReactionEnzyme
R02123 Retinal + NAD+ + H2O <=> Retinoate + NADH + H+retinal:NAD+ oxidoreductase
R02125 Retinal + Oxygen + H2O <=> Retinoate + Hydrogen peroxideretinal:oxygen oxidoreductase
R02902 Retinoate + UDP-glucuronate <=> all-trans-Retinoyl-beta-glucuronide + UDPRetinoate + UDP-glucuronate <=> all-trans-Retinoyl-beta-glucuronide + UDP
R08390 Retinoate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> all-trans-18-Hydroxyretinoic acid + [Oxidized NADPH---hemoprotein reductase] + H2ORetinoate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> all-trans-18-Hydroxyretinoic acid + [Oxidized NADPH---hemoprotein reductase] + H2O
R08391 Retinoate + NADPH + H+ + Oxygen <=> all-trans-5,6-Epoxyretinoic acid + NADP+ + H2ORetinoate + NADPH + H+ + Oxygen <=> all-trans-5,6-Epoxyretinoic acid + NADP+ + H2O
R08392 Retinoate + NADPH + H+ + Oxygen <=> all-trans-4-Hydroxyretinoic acid + NADP+ + H2ORetinoate + NADPH + H+ + Oxygen <=> all-trans-4-Hydroxyretinoic acid + NADP+ + H2O

Table of KEGG human pathways containing Retinoic acid

Pathway IDHuman Pathway# of reactions
hsa00830 Retinol metabolism 6
  logo