RefMet Compound Details
RefMet ID | RM0157538 | |
---|---|---|
MW structure | 50071 (View MW Metabolite Database details) | |
RefMet name | Protoporphyrin Species distribution Sample source distribution | |
Systematic name | 7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoic acid | |
SMILES | C=Cc1c(C)c2/C=C\3/C(=C(CCC(=O)O)C(=N3)/C=c\3/c(CCC(=O)O)c(C)/c(=C/C4=N/C(=C\c1[nH]2)/C(=C4C=C)C)/[nH]3)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 562.258006 (neutral) |
Table of KEGG reactions in human pathways involving Protoporphyrin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00310 | Protoporphyrin + Fe2+ <=> Heme + 2 H+ | protoheme ferro-lyase (protoporphyrin-forming) |
R03222 | Protoporphyrinogen IX + 3 Oxygen <=> Protoporphyrin + 3 Hydrogen peroxide | protoporphyrinogen-IX:oxygen oxidoreductase |
R09489 | Protoporphyrinogen IX + 3 Menaquinone <=> Protoporphyrin + 3 Menaquinol | protoporphyrinogen IX:menaquinone oxidoreductase |
R12605 | Protoporphyrinogen IX + 3 Acceptor <=> Protoporphyrin + 3 Reduced acceptor | protoporphyrinogen IX oxidase [EC:1.3.99.-] |
Table of KEGG human pathways containing Protoporphyrin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00860 | Porphyrin and chlorophyll metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |
hsa01240 | Biosynthesis of cofactors | 2 |