RefMet Compound Details

MW structure37110 (View MW Metabolite Database details)
RefMet nameProline
Systematic name(2S)-pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CCCN1   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass115.063329 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC5H9NO2View other entries in RefMet with this formula
InChIInChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
InChIKeyONIBWKKTOPOVIA-BYPYZUCNSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID145742
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Proline

Rxn IDKEGG ReactionEnzyme
R00135 Peptide + H2O <=> L-Proline + PeptidePeptide + H2O <=> L-Proline + Peptide
R03661 ATP + L-Proline + tRNA(Pro) <=> AMP + Diphosphate + L-Prolyl-tRNA(Pro)L-proline:tRNA(Pro) ligase (AMP-forming)
R01248 L-Proline + NAD+ <=> (S)-1-Pyrroline-5-carboxylate + NADH + H+L-Proline:NAD+ 5-oxidoreductase
R01251 L-Proline + NADP+ <=> (S)-1-Pyrroline-5-carboxylate + NADPH + H+L-Proline:NADP+ 5-oxidoreductase
R01253 L-Proline + Quinone <=> (S)-1-Pyrroline-5-carboxylate + HydroquinoneL-proline:quinone oxidoreductase
R10507 L-Proline + FAD <=> (S)-1-Pyrroline-5-carboxylate + FADH2L-proline:(acceptor) oxidoreductase
R01252 L-Proline + 2-Oxoglutarate + Oxygen <=> Hydroxyproline + Succinate + CO2L-Proline,2-oxoglutarate:oxygen oxidoreductase (4-hydroxylating)

Table of KEGG human pathways containing Proline

Pathway IDHuman Pathway# of reactions
hsa00330 Arginine and proline metabolism 6
hsa01100 Metabolic pathways 4
hsa01230 Biosynthesis of amino acids 2
hsa00970 Aminoacyl-tRNA biosynthesis 1
  logo