RefMet Compound Details

MW structure37169 (View MW Metabolite Database details)
RefMet namePhosphoenolpyruvic acid
Systematic name2-(phosphonooxy)prop-2-enoic acid
SMILESC=C(OP(=O)(O)O)C(=O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass167.982378 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC3H5O6PView other entries in RefMet with this formula
InChIKeyDTBNBXWJWCWCIK-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassShort-chain acids
Sub ClassShort-chain acids
Pubchem CID1005
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Phosphoenolpyruvic acid

Rxn IDKEGG ReactionEnzyme
R00199 ATP + Pyruvate + H2O <=> AMP + Phosphoenolpyruvate + OrthophosphateATP:pyruvate,water phosphotransferase
R00200 ATP + Pyruvate <=> ADP + PhosphoenolpyruvateATP:pyruvate 2-O-phosphotransferase
R00341 ATP + Oxaloacetate <=> ADP + Phosphoenolpyruvate + CO2ATP:oxaloacetate carboxy-lyase (transphosphorylating
R00658 2-Phospho-D-glycerate <=> Phosphoenolpyruvate + H2O2-phospho-D-glycerate hydro-lyase (phosphoenolpyruvate-forming)
R00345 Orthophosphate + Oxaloacetate <=> H2O + Phosphoenolpyruvate + CO2phosphate:oxaloacetate carboxy-lyase (adding phosphate
R00206 ATP + Pyruvate + Orthophosphate <=> AMP + Phosphoenolpyruvate + DiphosphateATP:pyruvate,phosphate phosphotransferase
R02320 Nucleoside triphosphate + Pyruvate <=> NDP + PhosphoenolpyruvateNTP:pyruvate O2-phosphotransferase
R00346 Diphosphate + Oxaloacetate <=> Orthophosphate + Phosphoenolpyruvate + CO2diphosphate:oxaloacetate carboxy-lyase (transphosphorylating
R00726 ITP + Oxaloacetate <=> IDP + Phosphoenolpyruvate + CO2ITP:oxaloacetate carboxy-lyase (adding ITP
R00431 GTP + Oxaloacetate <=> GDP + Phosphoenolpyruvate + CO2GTP:oxaloacetate carboxy-lyase (adding GTP

Table of KEGG human pathways containing Phosphoenolpyruvic acid

Pathway IDHuman Pathway# of reactions
hsa01100 Metabolic pathways 8
hsa00010 Glycolysis / Gluconeogenesis 4
hsa00620 Pyruvate metabolism 3
hsa00020 Citrate cycle (TCA cycle) 2
hsa01200 Carbon metabolism 2
hsa01230 Biosynthesis of amino acids 2
hsa00230 Purine metabolism 1