RefMet Compound Details
MW structure | 49832 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Pantothenic acid | |
Systematic name | 3-[(2,4-dihydroxy-3,3-dimethyl-butanoyl)amino]propionic acid | |
SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 219.110674 (neutral) |
Table of KEGG reactions in human pathways involving Pantothenic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03018 | ATP + Pantothenate <=> ADP + D-4'-Phosphopantothenate | ATP:pantothenate 4'-phosphotransferase |
R02973 | Pantetheine + H2O <=> Pantothenate + Cysteamine | (R)-pantetheine amidohydrolase |
Table of KEGG human pathways containing Pantothenic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00770 | Pantothenate and CoA biosynthesis | 2 |