RefMet Compound Details
MW structure | 37427 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Orotidine | |
Systematic name | 3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid | |
SMILES | c1c(C(=O)O)n([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 288.059368 (neutral) |
Table of KEGG reactions in human pathways involving Orotidine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00965 | Orotidine 5'-phosphate <=> UMP + CO2 | orotidine-5'-phosphate carboxy-lyase (UMP-forming) |
R01870 | Orotidine 5'-phosphate + Diphosphate <=> Orotate + 5-Phospho-alpha-D-ribose 1-diphosphate | Orotidine-5'-phosphate:diphosphate phospho-alpha-D-ribosyl-transferase |
Table of KEGG human pathways containing Orotidine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 2 |