RefMet Compound Details
RefMet ID | RM0151650 | |
---|---|---|
MW structure | 437 (View MW Metabolite Database details) | |
RefMet name | Oleic acid | |
Alternative name | FA 18:1(9Z) | |
Systematic name | 9Z-octadecenoic acid | |
SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 18:1 | View other entries in RefMet with this sum composition |
Exact mass | 282.255880 (neutral) |
Table of KEGG reactions in human pathways involving Oleic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08176 | Oleoyl-CoA + H2O <=> CoA + (9Z)-Octadecenoic acid | oleoyl-CoA hydrolase |
Table of KEGG human pathways containing Oleic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 1 |