RefMet Compound Details
MW structure | 49869 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Acetylglutamic acid | |
Systematic name | (2S)-2-acetamidopentanedioic acid | |
SMILES | CC(=O)N[C@@H](CCC(O)=O)C(O)=O | |
Exact mass | 189.063724 (neutral) |
Table of KEGG reactions in human pathways involving N-Acetylglutamic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00259 | Acetyl-CoA + L-Glutamate <=> CoA + N-Acetyl-L-glutamate | acetyl-CoA:L-glutamate N-acetyltransferase |
Table of KEGG human pathways containing N-Acetylglutamic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00220 | Arginine biosynthesis | 1 |
hsa01210 | 2-Oxocarboxylic acid metabolism | 1 |
hsa01230 | Biosynthesis of amino acids | 1 |