RefMet Compound Details
MW structure | 67404 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Acetyl-mannosamine | |
Systematic name | N-[2,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide | |
SMILES | CC(=O)N[C@H]1[C@H]([C@@H]([C@@H](CO)OC1O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 221.089939 (neutral) |
Table of KEGG reactions in human pathways involving N-Acetyl-mannosamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01811 | N-Acetylneuraminate <=> N-Acetyl-D-mannosamine + Pyruvate | N-Acetylneuraminate pyruvate-lyase (N-acetyl-D-mannosamine-forming) |
R01804 | N-Acetylneuraminate + Orthophosphate <=> N-Acetyl-D-mannosamine + Phosphoenolpyruvate + H2O | phosphoenolpyruvate:N-acetyl-D-mannosamine C-(1-carboxyvinyl)transferase (phosphate-hydrolysing, 2-carboxy-2-oxoethyl-forming) |
R02705 | ATP + N-Acetyl-D-mannosamine <=> ADP + N-Acetyl-D-mannosamine 6-phosphate | ATP:N-acyl-D-mannosamine 6-phosphotransferase |
R00414 | UDP-N-acetyl-alpha-D-glucosamine + H2O <=> N-Acetyl-D-mannosamine + UDP | UDP-N-acetyl-D-glucosamine 2-epimerase |
R01207 | N-Acetyl-D-glucosamine <=> N-Acetyl-D-mannosamine | N-acetyl-D-glucosamine 2-epimerase |
Table of KEGG human pathways containing N-Acetyl-mannosamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 5 |