RefMet Compound Details
MW structure | 37044 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Melibiose | |
Systematic name | alpha-D-galactopyranosyl-1-6-D-glucopyranose | |
SMILES | OC[C@H]1O[C@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Melibiose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01101 | Melibiose + H2O <=> D-Galactose + D-Glucose | melibiose galactohydrolase |
Table of KEGG human pathways containing Melibiose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 1 |