RefMet Compound Details
RefMet ID | RM0140120 | |
---|---|---|
MW structure | 2561 (View MW Metabolite Database details) | |
RefMet name | LTB4 | |
Systematic name | 5S,12R-dihydroxy-6Z,8E,10E,14Z-eicosatetraenoic acid | |
SMILES | CCCCC/C=C\C[C@H](/C=C/C=C/C=C\[C@H](CCCC(=O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving LTB4
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03057 | Leukotriene A4 + H2O <=> Leukotriene B4 | (7E,9E,11Z,14Z)-(5S,6S)-5,6-Epoxyicosa-7,9,11,14-tetraenoate hydrolase |
R03863 | Leukotriene B4 + NAD+ <=> 12-Keto-leukotriene B4 + H+ + NADH | prostaglandin reductase 3 [EC:1.3.1.48] |
R03864 | Leukotriene B4 + NADP+ <=> 12-Keto-leukotriene B4 + H+ + NADPH | prostaglandin reductase 3 [EC:1.3.1.48] |
R03866 | Leukotriene B4 + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 20-OH-Leukotriene B4 + [Oxidized NADPH---hemoprotein reductase] + H2O | (6Z,8E,10E,14Z)-(5S,12R)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate,[reduced NADPH---hemoprotein reductase]:oxygen oxidoreductase (20-hydroxylating) |
Table of KEGG human pathways containing LTB4
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 4 |