RefMet Compound Details
RefMet ID | RM0155883 | |
---|---|---|
MW structure | 37890 (View MW Metabolite Database details) | |
RefMet name | L-Arabitol Species distribution Sample source distribution | |
Systematic name | (2S,4S)-pentane-1,2,3,4,5-pentol | |
SMILES | C([C@@H]([C@H]([C@H](CO)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 152.068475 (neutral) |
Table of KEGG reactions in human pathways involving L-Arabitol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01758 | L-Arabitol + NAD+ <=> L-Arabinose + NADH + H+ | L-Arabitol:NAD+ 1-oxidoreductase |
R01759 | L-Arabitol + NADP+ <=> L-Arabinose + NADPH + H+ | L-Arabitol:NADP+ 1-oxidoreductase |
Table of KEGG human pathways containing L-Arabitol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 2 |
hsa01100 | Metabolic pathways | 2 |