RefMet Compound Details
MW structure | 37365 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Kynurenine | |
Systematic name | (2S)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid | |
SMILES | c1ccc(c(c1)C(=O)C[C@@H](C(=O)O)N)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 208.084793 (neutral) |
Table of KEGG reactions in human pathways involving Kynurenine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00987 | L-Kynurenine + H2O <=> Anthranilate + L-Alanine | L-Kynurenine hydrolase |
R01956 | L-Kynurenine + 2-Oxoglutarate <=> 4-(2-Aminophenyl)-2,4-dioxobutanoate + L-Glutamate | L-Kynurenine:2-oxoglutarate aminotransferase |
R01959 | L-Formylkynurenine + H2O <=> Formate + L-Kynurenine | N-Formyl-L-kynurenine amidohydrolase |
R01960 | L-Kynurenine + Oxygen + NADPH + H+ <=> 3-Hydroxy-L-kynurenine + NADP+ + H2O | L-Kynurenine,NADPH:oxygen oxidoreductase (3-hydroxylating) |
Table of KEGG human pathways containing Kynurenine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 4 |
hsa00630 | Glyoxylate and dicarboxylate metabolism | 1 |