RefMet Compound Details
RefMet ID | RM0132209 | |
---|---|---|
MW structure | 37029 (View MW Metabolite Database details) | |
RefMet name | Iodotyrosine Species distribution Sample source distribution | |
Systematic name | (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid | |
SMILES | c1cc(c(cc1C[C@@H](C(=O)O)N)I)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 306.970546 (neutral) |
Table of KEGG reactions in human pathways involving Iodotyrosine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03539 | Hydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-Tyrosine | Hydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-Tyrosine |
R03973 | Hydroiodic acid + 3,5-Diiodo-L-tyrosine <=> 3-Iodo-L-tyrosine + Iodine | Hydroiodic acid + 3,5-Diiodo-L-tyrosine <=> 3-Iodo-L-tyrosine + Iodine |
Table of KEGG human pathways containing Iodotyrosine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00350 | Tyrosine metabolism | 2 |