RefMet Compound Details
MW structure | 69918 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Heme | |
Systematic name | ferrous;3-[18-(2-carboxyethyl)-3,8,13,17-tetramethyl-7,12-divinyl-porphyrin-21,23-diid-2-yl]propanoic acid | |
SMILES | C=Cc1c(C)c2/C=C\3/C(=C(CCC(=O)O)C(=N3)/C=c\3/c(CCC(=O)O)c(C)/c(=C/C4=N/C(=C\c1[n-]2)/C(=C4C=C)C)/[n-]3)C.[Fe+2] Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 616.177295 (neutral) |
Table of KEGG reactions in human pathways involving Heme
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00310 | Protoporphyrin + Fe2+ <=> Heme + 2 H+ | protoheme ferro-lyase (protoporphyrin-forming) |
R11579 | Heme + 6 Reduced ferredoxin + 3 Oxygen + 6 H+ <=> Biliverdin + Fe2+ + CO + 6 Oxidized ferredoxin + 3 H2O | protoheme,reduced ferredoxin:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
R02480 | Cytochrome c <=> Apocytochrome c + Heme | Cytochrome c apocytochrome-c-lyase |
R00311 | Heme + 3 [Reduced NADPH---hemoprotein reductase] + 3 Oxygen <=> Biliverdin + CO + Fe2+ + 3 [Oxidized NADPH---hemoprotein reductase] + 3 H2O | protoheme,NADPH---hemoprotein reductase:oxygen oxidoreductase (alpha-methene-oxidizing, hydroxylating) |
R07411 | Heme + H2O + trans,trans-Farnesyl diphosphate <=> Heme O + Diphosphate | (2E,6E)-farnesyl-diphosphate:protoheme IX farnesyltranstransferase |
Table of KEGG human pathways containing Heme
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00860 | Porphyrin and chlorophyll metabolism | 4 |
hsa01100 | Metabolic pathways | 1 |