RefMet Compound Details
MW structure | 37094 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Guanosine | |
Systematic name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,9-dihydro-1H-purin-6-one | |
SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 283.091670 (neutral) |
Table of KEGG reactions in human pathways involving Guanosine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01227 | GMP + H2O <=> Guanosine + Orthophosphate | guanosine 5'-monophosphate phosphohydrolase |
R02147 | Guanosine + Orthophosphate <=> Guanine + alpha-D-Ribose 1-phosphate | guanosine:phosphate alpha-D-ribosyltransferase |
R01228 | ATP + Guanosine <=> ADP + GMP | ATP:guanosine 5'-phosphotransferase |
R01677 | Guanosine + H2O <=> Guanine + D-Ribose | Guanosine ribohydrolase |
Table of KEGG human pathways containing Guanosine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |