RefMet Compound Details

MW structure37085 (View MW Metabolite Database details)
RefMet nameGlycine
Systematic name2-aminoacetic acid
SMILESNCC(=O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass75.032029 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC2H5NO2View other entries in RefMet with this formula
InChIInChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)
InChIKeyDHMQDGOQFOQNFH-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID750
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Glycine

Rxn IDKEGG ReactionEnzyme
R00588 L-Serine + Glyoxylate <=> Hydroxypyruvate + GlycineL-Serine:glyoxylate aminotransferase
R00371 Acetyl-CoA + Glycine <=> CoA + L-2-Amino-3-oxobutanoic acidAcetyl-CoA:glycine C-acetyltransferase
R00565 L-Arginine + Glycine <=> L-Ornithine + GuanidinoacetateL-Arginine:glycine amidinotransferase
R00610 Sarcosine + H2O + Oxygen <=> Glycine + Formaldehyde + Hydrogen peroxidesarcosine:oxygen oxidoreductase (demethylating)
R00367 S-Adenosyl-L-methionine + Glycine <=> S-Adenosyl-L-homocysteine + SarcosineS-Adenosyl-L-methionine:glycine N-methyltransferase
R12967 Sarcosine + Tetrahydrofolate + Oxygen <=> Glycine + 5,10-Methylenetetrahydrofolate + Hydrogen peroxidesarcosine, 5,6,7,8-tetrahydrofolate:O2 oxidoreductase (demethylating,5,10-methylenetetrahydrofolate-forming)
R00830 Succinyl-CoA + Glycine <=> 5-Aminolevulinate + CoA + CO2succinyl-CoA:glycine C-succinyltransferase (decarboxylating)
R03654 ATP + Glycine + tRNA(Gly) <=> AMP + Diphosphate + Glycyl-tRNA(Gly)glycine:tRNA(Gly) ligase (AMP-forming)
R00611 Sarcosine + Electron-transferring flavoprotein + H2O <=> Glycine + Formaldehyde + Reduced electron-transferring flavoproteinsarcosine:electron-transfer flavoprotein oxidoreductase (demethylating)
R00372 Glycine + 2-Oxoglutarate <=> Glyoxylate + L-GlutamateGlycine:2-oxoglutarate aminotransferase
R13029 Sarcosine + 2 Oxidized ferredoxin + H2O <=> Glycine + Formaldehyde + 2 Reduced ferredoxin + 2 H+sarcosine:ferredoxin oxidoreductase (demethylating)
R00945 5,10-Methylenetetrahydrofolate + Glycine + H2O <=> Tetrahydrofolate + L-Serine5,10-Methylenetetrahydrofolate:glycine hydroxymethyltransferase
R01221 Glycine + Tetrahydrofolate + NAD+ <=> 5,10-Methylenetetrahydrofolate + Ammonia + CO2 + NADH + H+glycine synthase
R03425 Glycine + Lipoylprotein <=> [Protein]-S8-aminomethyldihydrolipoyllysine + CO2glycine:lipoylprotein oxidoreductase (decarboxylating and acceptor-aminomethylating)
R00366 Glycine + H2O + Oxygen <=> Glyoxylate + Ammonia + Hydrogen peroxideglycine:oxygen oxidoreductase (deaminating)

Table of KEGG human pathways containing Glycine

Pathway IDHuman Pathway# of reactions
hsa00260 Glycine, serine and threonine metabolism 11
hsa00630 Glyoxylate and dicarboxylate metabolism 3
hsa01100 Metabolic pathways 3
hsa01200 Carbon metabolism 3
hsa00480 Glutathione metabolism 2
hsa01230 Biosynthesis of amino acids 1
hsa00670 One carbon pool by folate 1
hsa00860 Porphyrin and chlorophyll metabolism 1
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa00120 Primary bile acid biosynthesis 1
  logo