RefMet Compound Details
RefMet ID | RM0136090 | |
---|---|---|
MW structure | 37685 (View MW Metabolite Database details) | |
RefMet name | Glucosamine 6-phosphate Species distribution Sample source distribution | |
Systematic name | {[(2R,3S,4R,5R,6S)-5-amino-3,4,6-trihydroxyoxan-2-yl]methoxy}phosphonic acid | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O)O1)N)O)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 259.045707 (neutral) |
Table of KEGG reactions in human pathways involving Glucosamine 6-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00765 | D-Glucosamine 6-phosphate + H2O <=> D-Fructose 6-phosphate + Ammonia | D-glucosamine-6-phosphate aminohydrolase (ketol isomerizing) |
R00768 | L-Glutamine + D-Fructose 6-phosphate <=> L-Glutamate + D-Glucosamine 6-phosphate | L-glutamine:D-fructose-6-phosphate isomerase (deaminating) |
R01961 | ATP + D-Glucosamine <=> ADP + D-Glucosamine 6-phosphate | ATP:D-glucosamine 6-phosphotransferase |
R02058 | Acetyl-CoA + D-Glucosamine 6-phosphate <=> CoA + N-Acetyl-D-glucosamine 6-phosphate | acetyl-CoA:D-glucosamine-6-phosphate N-acetyltransferase |
R02059 | N-Acetyl-D-glucosamine 6-phosphate + H2O <=> D-Glucosamine 6-phosphate + Acetate | N-Acetyl-D-glucosamine-6-phosphate amidohydrolase |
Table of KEGG human pathways containing Glucosamine 6-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 5 |
hsa00250 | Alanine, aspartate and glutamate metabolism | 1 |