RefMet Compound Details
RefMet ID | RM0049636 | |
---|---|---|
MW structure | 37103 (View MW Metabolite Database details) | |
RefMet name | Gluconolactone Species distribution Sample source distribution | |
Systematic name | (3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 178.047740 (neutral) |
Table of KEGG reactions in human pathways involving Gluconolactone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01519 | D-Glucono-1,5-lactone + H2O <=> D-Gluconic acid | D-Glucono-1,5-lactone lactonohydrolase |
Table of KEGG human pathways containing Gluconolactone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00030 | Pentose phosphate pathway | 1 |
hsa01200 | Carbon metabolism | 1 |