RefMet Compound Details
MW structure | 37337 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Gluconic acid | |
Systematic name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | |
SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 196.058305 (neutral) |
Table of KEGG reactions in human pathways involving Gluconic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01737 | ATP + D-Gluconic acid <=> ADP + 6-Phospho-D-gluconate | ATP:D-Gluconate 6-phosphotransferase |
R01519 | D-Glucono-1,5-lactone + H2O <=> D-Gluconic acid | D-Glucono-1,5-lactone lactonohydrolase |
Table of KEGG human pathways containing Gluconic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00030 | Pentose phosphate pathway | 2 |
hsa01200 | Carbon metabolism | 2 |