RefMet Compound Details
RefMet ID | RM0158253 | |
---|---|---|
MW structure | 28001 (View MW Metabolite Database details) | |
RefMet name | Geranyl diphosphate Species distribution Sample source distribution | |
Systematic name | Geranyl pyrophosphate | |
SMILES | CC(=CCC/C(=C/COP(=O)(O)OP(=O)(O)O)/C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 314.068431 (neutral) |
Table of KEGG reactions in human pathways involving Geranyl diphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01658 | Dimethylallyl diphosphate + Isopentenyl diphosphate <=> Diphosphate + Geranyl diphosphate | Dimethylallyl-diphosphate:isopentenyl-diphosphate dimethylallyltranstransferase |
Table of KEGG human pathways containing Geranyl diphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00900 | Terpenoid backbone biosynthesis | 2 |