RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0030190
RefMet nameFructose 6-phosphate
Systematic name{[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy}phosphonic acid
SynonymsPubChem Synonyms
Exact mass260.029723 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC6H13O9PView other entries in RefMet with this formula
Molecular descriptors
Molfile38436 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1
InChIKeyBGWGXPAPYGQALX-ARQDHWQXSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESC([C@@H]1[C@H]([C@@H]([C@](CO)(O)O1)O)O)OP(=O)(O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassCarbohydrates
Main ClassMonosaccharides
Sub ClassHexose phosphates
Distribution of Fructose 6-phosphate in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
StudiesNMDR Studies reporting Fructose 6-phosphate
External Links
Pubchem CID440641
ChEBI ID16084
KEGG IDC00085
HMDB IDHMDB0003971
Chemspider ID389526
Spectral data for Fructose 6-phosphate standards
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Fructose 6-phosphate

Rxn IDKEGG ReactionEnzyme
R00756 ATP + D-Fructose 6-phosphate <=> ADP + D-Fructose 1,6-bisphosphateATP:D-fructose-6-phosphate 1-phosphotransferase
R00760 ATP + D-Fructose <=> ADP + D-Fructose 6-phosphateATP:D-fructose 6-phosphotransferase
R00761 D-Fructose 6-phosphate + Orthophosphate <=> Acetyl phosphate + D-Erythrose 4-phosphate + H2OD-fructose-6-phosphate D-erythrose-4-phosphate-lyase (adding phosphate
R00762 D-Fructose 1,6-bisphosphate + H2O <=> D-Fructose 6-phosphate + OrthophosphateD-Fructose-1,6-bisphosphate 1-phosphohydrolase
R00765 D-Glucosamine 6-phosphate + H2O <=> D-Fructose 6-phosphate + AmmoniaD-glucosamine-6-phosphate aminohydrolase (ketol isomerizing)
R00768 L-Glutamine + D-Fructose 6-phosphate <=> L-Glutamate + D-Glucosamine 6-phosphateL-glutamine:D-fructose-6-phosphate isomerase (deaminating)
R00771 D-Glucose 6-phosphate <=> D-Fructose 6-phosphateD-glucose-6-phosphate aldose-ketose-isomerase
R00867 ATP + D-Fructose <=> ADP + beta-D-Fructose 6-phosphateATP:D-fructose 6-phosphotransferase
R01067 D-Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate <=> D-Erythrose 4-phosphate + D-Xylulose 5-phosphateD-Fructose 6-phosphate:D-glyceraldehyde-3-phosphate glycolaldehyde transferase
R01819 D-Mannose 6-phosphate <=> beta-D-Fructose 6-phosphateD-mannose-6-phosphate aldose-ketose-isomerase
R01830 beta-D-Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate <=> D-Erythrose 4-phosphate + D-Xylulose 5-phosphatebeta-D-Fructose 6-phosphate:D-glyceraldehyde-3-phosphate glycolaldehyde transferase
R02073 Diphosphate + beta-D-Fructose 6-phosphate <=> Orthophosphate + beta-D-Fructose 1,6-bisphosphatediphosphate:beta-D-fructose-6-phosphate 1-phosphotransferase
R02731 beta-D-Fructose 2,6-bisphosphate + H2O <=> beta-D-Fructose 6-phosphate + OrthophosphateD-Fructose-2,6-bisphosphate 2-phosphohydrolase
R02732 ATP + beta-D-Fructose 6-phosphate <=> ADP + beta-D-Fructose 2,6-bisphosphateATP:D-fructose-6-phosphate 2-phosphotransferase
R02740 alpha-D-Glucose 6-phosphate <=> beta-D-Fructose 6-phosphatealpha-D-Glucose 6-phosphate ketol-isomerase
R03321 beta-D-Glucose 6-phosphate <=> beta-D-Fructose 6-phosphatebeta-D-Glucose 6-phosphate ketol-isomerase
R03920 ATP + beta-D-Fructose <=> ADP + beta-D-Fructose 6-phosphateATP:D-fructose 6-phosphotransferase
R04779 ATP + beta-D-Fructose 6-phosphate <=> ADP + beta-D-Fructose 1,6-bisphosphateATP:D-fructose-6-phosphate 1-phosphotransferase
R04780 beta-D-Fructose 1,6-bisphosphate + H2O <=> beta-D-Fructose 6-phosphate + Orthophosphatebeta-D-Fructose 1,6-bisphosphate 1-phosphohydrolase
R05805 ADP + D-Fructose 6-phosphate <=> AMP + D-Fructose 1,6-bisphosphateADP:D-fructose-6-phosphate 1-phosphotransferase
R09084 beta-D-Fructose 6-phosphate + ADP <=> beta-D-Fructose 1,6-bisphosphate + AMPADP:D-fructose-6-phosphate 1-phosphotransferase

Table of KEGG human pathways containing Fructose 6-phosphate

Pathway IDHuman Pathway# of reactions
hsa01100 Metabolic pathways 7
hsa00520 Amino sugar and nucleotide sugar metabolism 5
hsa00030 Pentose phosphate pathway 5
hsa00051 Fructose and mannose metabolism 5
hsa00010 Glycolysis / Gluconeogenesis 4
hsa01200 Carbon metabolism 4
hsa01230 Biosynthesis of amino acids 4
hsa00500 Starch and sucrose metabolism 2
hsa00250 Alanine, aspartate and glutamate metabolism 1
  logo