RefMet Compound Details
MW structure | 37681 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | FAD | |
Systematic name | {[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}[({[(2R,3S,4S)-5-{7,8-dimethyl-2,4-dioxo-2H,3H,4H,10H-benzo[g]pteridin-10-yl}-2,3,4-trihydroxypentyl]oxy}(hydroxy)phosphoryl)oxy]phosphinic acid | |
SMILES | Cc1cc2c(cc1C)N=C1C(=NC(=O)NC1=O)N2C[C@@H](O)[C@@H](O)[C@@H](O)COP(O)(=O)OP(O)(=O)OC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)[n]1c[n]c2c(N)[n]c[n]c12 | |
Exact mass | 785.157142 (neutral) |
Table of KEGG reactions in human pathways involving FAD
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00160 | FAD + H2O <=> AMP + FMN | FAD nucleotidohydrolase |
R00161 | ATP + FMN <=> Diphosphate + FAD | ATP:FMN adenylyltransferase |
Table of KEGG human pathways containing FAD
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00740 | Riboflavin metabolism | 2 |