RefMet Compound Details
MW structure | 35274 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Estriol | |
Systematic name | estra-1,3,5(10)-triene-3,16,17-triol | |
SMILES | C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1C[C@H]([C@@H]2O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 18:3;O3 | View other entries in RefMet with this sum composition |
Exact mass | 288.172545 (neutral) |
Table of KEGG reactions in human pathways involving Estriol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03089 | Estradiol-17beta + H+ + Oxygen + NADPH <=> Estriol + NADP+ + H2O | Estradiol-17beta + H+ + Oxygen + NADPH <=> Estriol + NADP+ + H2O |
R04681 | Estriol + NAD+ <=> 16alpha-Hydroxyestrone + NADH + H+ | Estriol:NAD+ 17-oxidoreductase |
R04682 | Estriol + NADP+ <=> 16alpha-Hydroxyestrone + NADPH + H+ | Estriol:NADP+ 17-oxidoreductase |
R04683 | UDP-glucuronate + Estriol <=> UDP + 16-Glucuronide-estriol | UDPglucuronate beta-D-glucuronosyltransferase(acceptor-unspecific) |
Table of KEGG human pathways containing Estriol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 4 |
hsa01100 | Metabolic pathways | 2 |