RefMet Compound Details
MW structure | 35481 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Dihydrocortisol | |
SMILES | C[C@]12CCC(=O)C[C@H]1CC[C@H]1[C@@H]3CC[C@](C(=O)CO)([C@@]3(C)C[C@@H]([C@H]21)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O5 | View other entries in RefMet with this sum composition |
Exact mass | 364.224975 (neutral) |
Table of KEGG reactions in human pathways involving Dihydrocortisol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02841 | 11beta,17alpha,21-Trihydroxy-5beta-pregnane-3,20-dione + NADP+ <=> Cortisol + NADPH + H+ | 11beta,17alpha,21-Trihydroxy-5beta-pregnane-3,20-dione:NADP+ delta4-oxidoreductase |
R04832 | Urocortisol + NAD+ <=> 11beta,17alpha,21-Trihydroxy-5beta-pregnane-3,20-dione + NADH + H+ | Urocortisol:NAD+ oxidoreductase (B-specific) |
R04833 | Urocortisol + NADP+ <=> 11beta,17alpha,21-Trihydroxy-5beta-pregnane-3,20-dione + NADPH + H+ | Urocortisol:NADP+ oxidoreductase (B-specific) |
Table of KEGG human pathways containing Dihydrocortisol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |