RefMet Compound Details
MW structure | 37058 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Deoxyinosine | |
Systematic name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-9H-purin-6-ol | |
SMILES | C1[C@@H]([C@@H](CO)O[C@H]1n1cnc2c1nc[nH]c2=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 252.085856 (neutral) |
Table of KEGG reactions in human pathways involving Deoxyinosine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02748 | Deoxyinosine + Orthophosphate <=> Hypoxanthine + 2-Deoxy-D-ribose 1-phosphate | Deoxyinosine:orthophosphate ribosyltransferase |
R12958 | 2'-Deoxyinosine 5'-phosphate + H2O <=> Deoxyinosine + Orthophosphate | dIMP phosphohydrolase |
R02556 | Deoxyadenosine + H2O <=> Deoxyinosine + Ammonia | Deoxyadenosine aminohydrolase |
Table of KEGG human pathways containing Deoxyinosine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |
hsa01232 | Nucleotide metabolism | 1 |