RefMet Compound Details
MW structure | 36953 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Dehydroepiandrosterone sulfate | |
Systematic name | 3beta-Hydroxyandrost-5-en-17-one 3-sulfate | |
SMILES | C[C@]12CC[C@H](OS(=O)(=O)O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:2;O2;S | View other entries in RefMet with this sum composition |
Exact mass | 368.165747 (neutral) |
Table of KEGG reactions in human pathways involving Dehydroepiandrosterone sulfate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03405 | 3'-Phosphoadenylyl sulfate + Dehydroepiandrosterone <=> Adenosine 3',5'-bisphosphate + Dehydroepiandrosterone sulfate | 3'-phosphoadenylylsulfate:alcohol sulfotransferase |
R03404 | Dehydroepiandrosterone sulfate + H2O <=> Dehydroepiandrosterone + Sulfate | 3beta-Hydroxyandrost-5-en-17-one 3-sulfate sulfohydrolase |
Table of KEGG human pathways containing Dehydroepiandrosterone sulfate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |