RefMet Compound Details
MW structure | 49870 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cysteic acid | |
Systematic name | (2R)-2-azanyl-3-sulfo-propanoic acid | |
SMILES | C([C@@H](C(=O)O)N)S(=O)(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 169.004496 (neutral) |
Table of KEGG reactions in human pathways involving Cysteic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02433 | L-Cysteate + 2-Oxoglutarate <=> 3-Sulfopyruvate + L-Glutamate | L-cysteate:2-oxoglutarate aminotransferase |
R01682 | L-Cysteate <=> Taurine + CO2 | 3-Sulfo-L-alanine carboxy-lyase (taurine-forming) |
Table of KEGG human pathways containing Cysteic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00270 | Cysteine and methionine metabolism | 1 |
hsa00430 | Taurine and hypotaurine metabolism | 1 |