RefMet Compound Details
MW structure | 37075 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cystathionine | |
Systematic name | (2S)-2-amino-4-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}butanoic acid | |
SMILES | N[C@@H](CSCC[C@H](N)C(O)=O)C(O)=O | |
Exact mass | 222.067430 (neutral) |
Table of KEGG reactions in human pathways involving Cystathionine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01286 | L-Cystathionine + H2O <=> L-Homocysteine + Ammonia + Pyruvate | L-cystathionine L-homocysteine-lyase (deaminating |
R01290 | L-Serine + L-Homocysteine <=> L-Cystathionine + H2O | L-serine hydro-lyase (adding homocysteine |
R01001 | L-Cystathionine + H2O <=> L-Cysteine + Ammonia + 2-Oxobutanoate | L-cystathionine cysteine-lyase (deaminating |
R10305 | O-Acetyl-L-serine + L-Homocysteine <=> L-Cystathionine + Acetate | O3-acetyl-L-serine:L-homocysteine S-(2-amino-2-carboxyethyl)transferase |
Table of KEGG human pathways containing Cystathionine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00270 | Cysteine and methionine metabolism | 3 |
hsa00260 | Glycine, serine and threonine metabolism | 2 |
hsa01230 | Biosynthesis of amino acids | 2 |
hsa01100 | Metabolic pathways | 1 |