RefMet Compound Details
MW structure | 36958 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Cholesterol sulfate | |
Systematic name | cholest-5-en-3beta-yl hydrogen sulfate | |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OS(=O)(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O;S | View other entries in RefMet with this sum composition |
Exact mass | 466.311682 (neutral) |
Table of KEGG reactions in human pathways involving Cholesterol sulfate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08941 | Cholesterol + Sulfate <=> Cholesterol sulfate + H2O | Cholesterol-sulfate sulfohydrolase |
R08977 | Cholesterol + 3'-Phosphoadenylyl sulfate <=> Cholesterol sulfate + Adenosine 3',5'-bisphosphate | 3'-phosphoadenylyl-sulfate:cholesterol sulfotransferase |
Table of KEGG human pathways containing Cholesterol sulfate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |